C8H17N3O — CID 123788370
1-[2-(cyclobutylamino)ethyl]-3-methylurea (PubChem CID 123788370) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-[2-(cyclobutylamino)ethyl]-3-methylurea.
| Compound Name | 1-[2-(cyclobutylamino)ethyl]-3-methylurea |
|---|---|
| PubChem CID | 123788370 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 1-[2-(cyclobutylamino)ethyl]-3-methylurea |
| SMILES | CNC(=O)NCCNC1CCC1 |
| InChI | InChI=1S/C8H17N3O/c1-9-8(12)11-6-5-10-7-3-2-4-7/h7,10H,2-6H2,1H3,(H2,9,11,12) |
| InChIKey | UZIXFNJVXRSWPY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|