C18H27N — CID 123788503
3-but-1-enyl-11-methyl-5-methylidenedodeca-3,9,11-trien-2-imine (PubChem CID 123788503) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 3-but-1-enyl-11-methyl-5-methylidenedodeca-3,9,11-trien-2-imine.
| Compound Name | 3-but-1-enyl-11-methyl-5-methylidenedodeca-3,9,11-trien-2-imine |
|---|---|
| PubChem CID | 123788503 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 3-but-1-enyl-11-methyl-5-methylidenedodeca-3,9,11-trien-2-imine |
| SMILES | [H]/N=C(\C)C(C=CCC)=CC(=C)CCCC=CC(=C)C |
| InChI | InChI=1S/C18H27N/c1-6-7-13-18(17(5)19)14-16(4)12-10-8-9-11-15(2)3/h7,9,11,13-14,19H,2,4,6,8,10,12H2,1,3,5H3/b11-9?,13-7?,18-14?,19-17+ |
| InChIKey | ZFHNOEHIVAIROO-SSKUMSGJSA-N |
| XLogP | 5.78 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|