C20H26N4O2 — CID 123788540
(1S,2R,3S,5R)-3-methyl-5-[[6-(5,6,7,8-tetrahydronaphthalen-1-ylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 123788540) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-methyl-5-[[6-(5,6,7,8-tetrahydronaphthalen-1-ylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-methyl-5-[[6-(5,6,7,8-tetrahydronaphthalen-1-ylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123788540 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (1S,2R,3S,5R)-3-methyl-5-[[6-(5,6,7,8-tetrahydronaphthalen-1-ylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | C[C@H]1C[C@@H](Nc2cc(Nc3cccc4c3CCCC4)ncn2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H26N4O2/c1-12-9-16(20(26)19(12)25)24-18-10-17(21-11-22-18)23-15-8-4-6-13-5-2-3-7-14(13)15/h4,6,8,10-12,16,19-20,25-26H,2-3,5,7,9H2,1H3,(H2,21,22,23,24)/t12-,16+,19+,20-/m0/s1 |
| InChIKey | RVEHZBRKQXNJSQ-IAXAWSQASA-N |
| XLogP | 2.64 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |