About 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol
1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol (PubChem CID 123788932) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol |
| PubChem CID | 123788932 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol |
| SMILES | CCCCCN(O)CC(O)C1=CCCC=C1 |
| InChI | InChI=1S/C13H23NO2/c1-2-3-7-10-14(16)11-13(15)12-8-5-4-6-9-12/h5,8-9,13,15-16H,2-4,6-7,10-11H2,1H3 |
| InChIKey | HUMNGUJFAJDSTM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol (CID 123788932) is 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol is CCCCCN(O)CC(O)C1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol?
The InChIKey is HUMNGUJFAJDSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-2-3-7-10-14(16)11-13(15)12-8-5-4-6-9-12/h5,8-9,13,15-16H,2-4,6-7,10-11H2,1H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol?
1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol has a molecular weight of 225.33 g/mol, XLogP of 2.51, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-2-[hydroxy(pentyl)amino]ethanol is sourced from PubChem (CID 123788932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).