C23H22N4 — CID 123789167
14-tert-butyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,12,14,16-heptaene (PubChem CID 123789167) has the molecular formula C23H22N4 and a molecular weight of 354.46 g/mol. Its IUPAC name is 14-tert-butyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,12,14,16-heptaene.
| Compound Name | 14-tert-butyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,12,14,16-heptaene |
|---|---|
| PubChem CID | 123789167 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 14-tert-butyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,12,14,16-heptaene |
| SMILES | CC(C)(C)c1cnc2c(n1)N(c1ccccc1)C1C=Cc3ccccc3N21 |
| InChI | InChI=1S/C23H22N4/c1-23(2,3)19-15-24-21-22(25-19)26(17-10-5-4-6-11-17)20-14-13-16-9-7-8-12-18(16)27(20)21/h4-15,20H,1-3H3 |
| InChIKey | RNSQHVDQRXDVNJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |