About 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid
5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 12379019) has the molecular formula C15H19N5O3
and a molecular weight of 317.34 g/mol. Its IUPAC name is 8-ethyl-2-(4-methylpiperazin-1-yl)-5-oxopyrido[2,3-d]pyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid |
| PubChem CID | 12379019 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 8-ethyl-2-(4-methylpiperazin-1-yl)-5-oxopyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | CCN1C=C(C(=O)C2=CN=C(N=C21)N3CCN(CC3)C)C(=O)O |
| InChI | InChI=1S/C15H19N5O3/c1-3-19-9-11(14(22)23)12(21)10-8-16-15(17-13(10)19)20-6-4-18(2)5-7-20/h8-9H,3-7H2,1-2H3,(H,22,23) |
| InChIKey | ADIBMWKWRKIHTC-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | 515 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid?
The IUPAC name of 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid (CID 12379019) is 8-ethyl-2-(4-methylpiperazin-1-yl)-5-oxopyrido[2,3-d]pyrimidine-6-carboxylic acid.
What is the SMILES notation for 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid?
The canonical SMILES for 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid is CCN1C=C(C(=O)C2=CN=C(N=C21)N3CCN(CC3)C)C(=O)O.
What is the InChIKey of 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid?
The InChIKey is ADIBMWKWRKIHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O3/c1-3-19-9-11(14(22)23)12(21)10-8-16-15(17-13(10)19)20-6-4-18(2)5-7-20/h8-9H,3-7H2,1-2H3,(H,22,23).
What are the key properties of 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid?
5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid has a molecular weight of 317.34 g/mol, XLogP of -1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-Dihydro-8-ethyl-2-(4-methyl-1-piperazinyl)-5-oxopyrido-[2,3-d]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 12379019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).