C40H38N3O12P3+2 — CID 123790307
4-[[1,4,4,6,6-pentakis(4-hydroxyphenoxy)-3-methyl-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol (PubChem CID 123790307) has the molecular formula C40H38N3O12P3+2 and a molecular weight of 845.68 g/mol. Its IUPAC name is 4-[[1,4,4,6,6-pentakis(4-hydroxyphenoxy)-3-methyl-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol.
| Compound Name | 4-[[1,4,4,6,6-pentakis(4-hydroxyphenoxy)-3-methyl-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol |
|---|---|
| PubChem CID | 123790307 |
| Molecular Formula | C40H38N3O12P3+2 |
| Molecular Weight | 845.68 g/mol |
| Exact Mass | 845.17 |
| IUPAC Name | 4-[[1,4,4,6,6-pentakis(4-hydroxyphenoxy)-3-methyl-2,5,7-triaza-6λ5-phospha-1,4-diphosphoniabicyclo[6.1.0]non-5-en-9-yl]oxy]phenol |
| SMILES | CC1N[P+]2(Oc3ccc(O)cc3)C(NP(Oc3ccc(O)cc3)(Oc3ccc(O)cc3)=N[P+]1(Oc1ccc(O)cc1)Oc1ccc(O)cc1)C2Oc1ccc(O)cc1 |
| InChI | InChI=1S/C40H36N3O12P3/c1-26-41-56(51-34-16-4-28(45)5-17-34)39(40(56)50-33-14-2-27(44)3-15-33)42-58(54-37-22-10-31(48)11-23-37,55-38-24-12-32(49)13-25-38)43-57(26,52-35-18-6-29(46)7-19-35)53-36-20-8-30(47)9-21-36/h2-26,39-42H,1H3,(H4-2,44,45,46,47,48,49)/p+2 |
| InChIKey | VTELFEKOUKKPSB-UHFFFAOYSA-P |
| XLogP | 9.45 |
| TPSA | 213.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.68 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|