C36H45N2O+ — CID 123790662
6-[10-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1(12),5,7-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol (PubChem CID 123790662) has the molecular formula C36H45N2O+ and a molecular weight of 521.77 g/mol. Its IUPAC name is 6-[10-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1(12),5,7-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol.
| Compound Name | 6-[10-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1(12),5,7-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol |
|---|---|
| PubChem CID | 123790662 |
| Molecular Formula | C36H45N2O+ |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | 6-[10-[5-(3,3-dimethyl-1-azoniatricyclo[6.3.1.04,12]dodeca-1(12),5,7-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol |
| SMILES | CC1(CCCCCCO)C(C=CC=CC=C2[N+]3=C4C(=CC=CC4C2(C)C)CCC3)=CN2CCc3cccc1c32 |
| InChI | InChI=1S/C36H45N2O/c1-35(2)30-18-11-14-27-16-13-23-38(34(27)30)32(35)20-8-6-7-17-29-26-37-24-21-28-15-12-19-31(33(28)37)36(29,3)22-9-4-5-10-25-39/h6-8,11-12,14-15,17-20,26,30,39H,4-5,9-10,13,16,21-25H2,1-3H3/q+1 |
| InChIKey | UBILDZUNGCFXCH-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|