About (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol
(2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol (PubChem CID 123790681) has the molecular formula C13H14FNOS
and a molecular weight of 251.33 g/mol. Its IUPAC name is (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol.
Molecular Properties
| Compound Name | (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol |
| PubChem CID | 123790681 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol |
| SMILES | Cc1sc(N)c(C(O)c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C13H14FNOS/c1-7-8(2)17-13(15)11(7)12(16)9-3-5-10(14)6-4-9/h3-6,12,16H,15H2,1-2H3 |
| InChIKey | ZOOXGMHHVROJGQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol?
The IUPAC name of (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol (CID 123790681) is (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol.
What is the SMILES notation for (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol?
The canonical SMILES for (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol is Cc1sc(N)c(C(O)c2ccc(F)cc2)c1C.
What is the InChIKey of (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol?
The InChIKey is ZOOXGMHHVROJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNOS/c1-7-8(2)17-13(15)11(7)12(16)9-3-5-10(14)6-4-9/h3-6,12,16H,15H2,1-2H3.
What are the key properties of (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol?
(2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol has a molecular weight of 251.33 g/mol, XLogP of 3.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4,5-dimethylthiophen-3-yl)-(4-fluorophenyl)methanol is sourced from PubChem (CID 123790681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).