C25H35N5OSi — CID 123791101
N'-[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]ethane-1,2-diamine (PubChem CID 123791101) has the molecular formula C25H35N5OSi and a molecular weight of 449.68 g/mol. Its IUPAC name is N'-[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]ethane-1,2-diamine.
| Compound Name | N'-[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 123791101 |
| Molecular Formula | C25H35N5OSi |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | N'-[5-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]anilino]-4-pyridinyl]-2-pyridinyl]ethane-1,2-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(Nc2cc(-c3ccc(NCCN)nc3)ccn2)c1 |
| InChI | InChI=1S/C25H35N5OSi/c1-25(2,3)32(4,5)31-18-19-7-6-8-22(15-19)30-24-16-20(11-13-27-24)21-9-10-23(29-17-21)28-14-12-26/h6-11,13,15-17H,12,14,18,26H2,1-5H3,(H,27,30)(H,28,29) |
| InChIKey | UJJDTSXUMJHXLP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|