C22H32F2O — CID 123791838
2-[difluoro(4,4,6-trimethylhepta-2,5-dien-2-yloxy)methyl]-7-ethyl-5,7-dimethylcyclohepta-1,3,5-triene (PubChem CID 123791838) has the molecular formula C22H32F2O and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-[difluoro(4,4,6-trimethylhepta-2,5-dien-2-yloxy)methyl]-7-ethyl-5,7-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 2-[difluoro(4,4,6-trimethylhepta-2,5-dien-2-yloxy)methyl]-7-ethyl-5,7-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123791838 |
| Molecular Formula | C22H32F2O |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-[difluoro(4,4,6-trimethylhepta-2,5-dien-2-yloxy)methyl]-7-ethyl-5,7-dimethylcyclohepta-1,3,5-triene |
| SMILES | CCC1(C)C=C(C)C=CC(C(F)(F)OC(C)=CC(C)(C)C=C(C)C)=C1 |
| InChI | InChI=1S/C22H32F2O/c1-9-21(8)13-17(4)10-11-19(15-21)22(23,24)25-18(5)14-20(6,7)12-16(2)3/h10-15H,9H2,1-8H3 |
| InChIKey | DDASFZRLPIAEPN-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|