C42H41B2N2O4+ — CID 123791858
5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-11-[3-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole (PubChem CID 123791858) has the molecular formula C42H41B2N2O4+ and a molecular weight of 659.42 g/mol. Its IUPAC name is 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-11-[3-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole.
| Compound Name | 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-11-[3-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 123791858 |
| Molecular Formula | C42H41B2N2O4+ |
| Molecular Weight | 659.42 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | 5-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-11-[3-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[3,2-b]carbazole |
| SMILES | [CH2+]C1(C)OB(c2cccc(-n3c4ccccc4c4cc5c(cc43)c3ccccc3n5-c3cccc(B4OC(C)(C)C(C)(C)O4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C42H41B2N2O4/c1-39(2)40(3,4)48-43(47-39)27-15-13-17-29(23-27)45-35-21-11-9-19-31(35)33-26-38-34(25-37(33)45)32-20-10-12-22-36(32)46(38)30-18-14-16-28(24-30)44-49-41(5,6)42(7,8)50-44/h9-26H,1H2,2-8H3/q+1 |
| InChIKey | FAESBYYHQJWNOM-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.42 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|