About [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate
[2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate (PubChem CID 123792142) has the molecular formula C9H13NO4S2
and a molecular weight of 263.34 g/mol. Its IUPAC name is [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate.
Molecular Properties
| Compound Name | [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate |
| PubChem CID | 123792142 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate |
| SMILES | CC(COS(C)(=O)=O)C(=O)Cc1nccs1 |
| InChI | InChI=1S/C9H13NO4S2/c1-7(6-14-16(2,12)13)8(11)5-9-10-3-4-15-9/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | QVLFRTWAXCNRPW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate?
The IUPAC name of [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate (CID 123792142) is [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate.
What is the SMILES notation for [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate?
The canonical SMILES for [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate is CC(COS(C)(=O)=O)C(=O)Cc1nccs1.
What is the InChIKey of [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate?
The InChIKey is QVLFRTWAXCNRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4S2/c1-7(6-14-16(2,12)13)8(11)5-9-10-3-4-15-9/h3-4,7H,5-6H2,1-2H3.
What are the key properties of [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate?
[2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate has a molecular weight of 263.34 g/mol, XLogP of 0.87, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-3-oxo-4-(1,3-thiazol-2-yl)butyl] methanesulfonate is sourced from PubChem (CID 123792142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).