C28H23N5O2 — CID 123792597
N-ethyl-5-(isocyanomethyl)-3-(4-methylphenyl)-4-oxo-N-phenylpyridazino[4,5-b]indole-1-carboxamide (PubChem CID 123792597) has the molecular formula C28H23N5O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is N-ethyl-5-(isocyanomethyl)-3-(4-methylphenyl)-4-oxo-N-phenylpyridazino[4,5-b]indole-1-carboxamide.
| Compound Name | N-ethyl-5-(isocyanomethyl)-3-(4-methylphenyl)-4-oxo-N-phenylpyridazino[4,5-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 123792597 |
| Molecular Formula | C28H23N5O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-ethyl-5-(isocyanomethyl)-3-(4-methylphenyl)-4-oxo-N-phenylpyridazino[4,5-b]indole-1-carboxamide |
| SMILES | [C-]#[N+]Cn1c2ccccc2c2c(C(=O)N(CC)c3ccccc3)nn(-c3ccc(C)cc3)c(=O)c21 |
| InChI | InChI=1S/C28H23N5O2/c1-4-31(20-10-6-5-7-11-20)27(34)25-24-22-12-8-9-13-23(22)32(18-29-3)26(24)28(35)33(30-25)21-16-14-19(2)15-17-21/h5-17H,4,18H2,1-2H3 |
| InChIKey | HPYOOPFZNWBBTC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|