C30H43F6NO8S3 — CID 123792821
1,1,2,2,3,3-hexafluoro-3-[[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid (PubChem CID 123792821) has the molecular formula C30H43F6NO8S3 and a molecular weight of 755.86 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123792821 |
| Molecular Formula | C30H43F6NO8S3 |
| Molecular Weight | 755.86 g/mol |
| Exact Mass | 755.21 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]propane-1-sulfonic acid |
| SMILES | COc1ccc(C(=O)C(C(C)(C)CC2CC3CCCCC3CN2S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)S2(C)CCOCC2)cc1 |
| InChI | InChI=1S/C30H43F6NO8S3/c1-27(2,26(46(4)15-13-45-14-16-46)25(38)20-9-11-24(44-3)12-10-20)18-23-17-21-7-5-6-8-22(21)19-37(23)47(39,40)29(33,34)28(31,32)30(35,36)48(41,42)43/h9-12,21-23,26H,5-8,13-19H2,1-4H3,(H,41,42,43) |
| InChIKey | DFXRUOYOAIJKRO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.86 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|