C13H14N2 — CID 123792940
1-[(5Z,7Z)-azonin-4-ylidene]pent-1-en-3-imine (PubChem CID 123792940) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-[(5Z,7Z)-azonin-4-ylidene]pent-1-en-3-imine.
| Compound Name | 1-[(5Z,7Z)-azonin-4-ylidene]pent-1-en-3-imine |
|---|---|
| PubChem CID | 123792940 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-[(5Z,7Z)-azonin-4-ylidene]pent-1-en-3-imine |
| SMILES | [H]/N=C(/C=C=C1C=C/N=C\C=C/C=C\1)CC |
| InChI | InChI=1S/C13H14N2/c1-2-13(14)8-7-12-6-4-3-5-10-15-11-9-12/h3-6,8-11,14H,2H2,1H3/b5-3-,6-4-,11-9?,14-13+,15-10- |
| InChIKey | GDLQESFOPLXPBG-ADSLKGPLSA-N |
| XLogP | 3.21 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|