C26H33N5O4S — CID 123793221
N-[3-methoxy-6-[4-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]hepta-1,3,5-trien-2-yl]-2-morpholin-4-ylacetamide (PubChem CID 123793221) has the molecular formula C26H33N5O4S and a molecular weight of 511.65 g/mol. Its IUPAC name is N-[3-methoxy-6-[4-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]hepta-1,3,5-trien-2-yl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[3-methoxy-6-[4-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]hepta-1,3,5-trien-2-yl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 123793221 |
| Molecular Formula | C26H33N5O4S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | N-[3-methoxy-6-[4-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]-1,3-thiazol-2-yl]hepta-1,3,5-trien-2-yl]-2-morpholin-4-ylacetamide |
| SMILES | C=C(NC(=O)CN1CCOCC1)C(=CC=C(C)c1nc(-c2c[nH]c(C(=O)N3CCCC3)c2)cs1)OC |
| InChI | InChI=1S/C26H33N5O4S/c1-18(6-7-23(34-3)19(2)28-24(32)16-30-10-12-35-13-11-30)25-29-22(17-36-25)20-14-21(27-15-20)26(33)31-8-4-5-9-31/h6-7,14-15,17,27H,2,4-5,8-13,16H2,1,3H3,(H,28,32) |
| InChIKey | AYGCOIKJDMTUAO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|