About (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate
(7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate (PubChem CID 123793518) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol. Its IUPAC name is (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate.
Molecular Properties
| Compound Name | (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate |
| PubChem CID | 123793518 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate |
| SMILES | CC(=O)OC1(C(C)C)C2CC3CC4C1CC4(C3)C2 |
| InChI | InChI=1S/C16H24O2/c1-9(2)16(18-10(3)17)12-4-11-5-13-14(16)8-15(13,6-11)7-12/h9,11-14H,4-8H2,1-3H3 |
| InChIKey | VITMPQKMPSNYRA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate?
The IUPAC name of (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate (CID 123793518) is (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate.
What is the SMILES notation for (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate?
The canonical SMILES for (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate is CC(=O)OC1(C(C)C)C2CC3CC4C1CC4(C3)C2.
What is the InChIKey of (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate?
The InChIKey is VITMPQKMPSNYRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2/c1-9(2)16(18-10(3)17)12-4-11-5-13-14(16)8-15(13,6-11)7-12/h9,11-14H,4-8H2,1-3H3.
What are the key properties of (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate?
(7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate has a molecular weight of 248.37 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-propan-2-yl-7-tetracyclo[4.3.1.11,4.02,8]undecanyl) acetate is sourced from PubChem (CID 123793518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).