C20H31NO — CID 123793791
4-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yloxy)-N,N,2-trimethylpentan-2-amine (PubChem CID 123793791) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 4-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yloxy)-N,N,2-trimethylpentan-2-amine.
| Compound Name | 4-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yloxy)-N,N,2-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 123793791 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 4-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yloxy)-N,N,2-trimethylpentan-2-amine |
| SMILES | C=CC=CC(=C)C(=C)C=CC(=C)OC(C)CC(C)(C)N(C)C |
| InChI | InChI=1S/C20H31NO/c1-10-11-12-16(2)17(3)13-14-18(4)22-19(5)15-20(6,7)21(8)9/h10-14,19H,1-4,15H2,5-9H3 |
| InChIKey | DXVXYZRSEJBDRY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|