About 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide
2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide (PubChem CID 123793801) has the molecular formula C8H13F3N2O2
and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
| PubChem CID | 123793801 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
| SMILES | CC(C)C(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O2/c1-5(2)7(15)12-3-6(14)13-4-8(9,10)11/h5H,3-4H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | DHZYAACKHYTWOV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide?
The IUPAC name of 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide (CID 123793801) is 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide.
What is the SMILES notation for 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide?
The canonical SMILES for 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide is CC(C)C(=O)NCC(=O)NCC(F)(F)F.
What is the InChIKey of 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide?
The InChIKey is DHZYAACKHYTWOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O2/c1-5(2)7(15)12-3-6(14)13-4-8(9,10)11/h5H,3-4H2,1-2H3,(H,12,15)(H,13,14).
What are the key properties of 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide?
2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide has a molecular weight of 226.20 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide is sourced from PubChem (CID 123793801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).