C24H32F2N4O3 — CID 123793810
tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-[(4-fluorophenyl)methylimino]-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate (PubChem CID 123793810) has the molecular formula C24H32F2N4O3 and a molecular weight of 462.54 g/mol. Its IUPAC name is tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-[(4-fluorophenyl)methylimino]-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-[(4-fluorophenyl)methylimino]-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123793810 |
| Molecular Formula | C24H32F2N4O3 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | tert-butyl N-[4-[1-carbamoyl-3-fluoro-6-[(4-fluorophenyl)methylimino]-2,3-dihydropyridin-5-yl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C2=CC(F)CN(C(N)=O)/C2=N\Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H32F2N4O3/c1-24(2,3)33-23(32)29-19-10-6-16(7-11-19)20-12-18(26)14-30(22(27)31)21(20)28-13-15-4-8-17(25)9-5-15/h4-5,8-9,12,16,18-19H,6-7,10-11,13-14H2,1-3H3,(H2,27,31)(H,29,32)/b28-21- |
| InChIKey | JCCFBJRLWJOAAQ-HFTWOUSFSA-N |
| XLogP | 4.47 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|