C22H17F3N2O4S — CID 123793821
2-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-4-(trifluoromethyl)-1,3-thiazole-5-carbonitrile (PubChem CID 123793821) has the molecular formula C22H17F3N2O4S and a molecular weight of 462.45 g/mol. Its IUPAC name is 2-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-4-(trifluoromethyl)-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-4-(trifluoromethyl)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 123793821 |
| Molecular Formula | C22H17F3N2O4S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[4-[(1R,2S,6R,7S)-3,5-dioxo-10-oxatricyclo[5.2.1.02,6]decan-4-yl]-3,5-dimethylphenoxy]-4-(trifluoromethyl)-1,3-thiazole-5-carbonitrile |
| SMILES | Cc1cc(Oc2nc(C(F)(F)F)c(C#N)s2)cc(C)c1C1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C22H17F3N2O4S/c1-8-5-10(30-21-27-20(22(23,24)25)13(7-26)32-21)6-9(2)14(8)17-18(28)15-11-3-4-12(31-11)16(15)19(17)29/h5-6,11-12,15-17H,3-4H2,1-2H3/t11-,12+,15-,16+,17? |
| InChIKey | PRUXZEDUADXJCI-WBQAGZKKSA-N |
| XLogP | 4.47 |
| TPSA | 89.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|