C23H23N5 — CID 123794152
2-methyl-5-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-phenylpyrimidin-4-amine (PubChem CID 123794152) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-methyl-5-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-phenylpyrimidin-4-amine.
| Compound Name | 2-methyl-5-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 123794152 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-methyl-5-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-phenylpyrimidin-4-amine |
| SMILES | Cc1nc(N)c(CCc2cccc(-c3cnn(C)c3)c2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H23N5/c1-16-26-22(18-8-4-3-5-9-18)21(23(24)27-16)12-11-17-7-6-10-19(13-17)20-14-25-28(2)15-20/h3-10,13-15H,11-12H2,1-2H3,(H2,24,26,27) |
| InChIKey | QUFKXTDNQYSXPN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |