C18H24FN5O3S — CID 123794350
2-[amino-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methyl]-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 123794350) has the molecular formula C18H24FN5O3S and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[amino-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methyl]-5-fluoro-4-propan-2-yloxyaniline.
| Compound Name | 2-[amino-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methyl]-5-fluoro-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 123794350 |
| Molecular Formula | C18H24FN5O3S |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[amino-[6-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methyl]-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(C(N)c2cc(N3CCS(=O)(=O)CC3)ncn2)c(N)cc1F |
| InChI | InChI=1S/C18H24FN5O3S/c1-11(2)27-16-7-12(14(20)8-13(16)19)18(21)15-9-17(23-10-22-15)24-3-5-28(25,26)6-4-24/h7-11,18H,3-6,20-21H2,1-2H3 |
| InChIKey | BDHAXHBJYHYLHT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|