C16H27N — CID 123794526
(3E,5Z)-4-tert-butyl-6,7-dimethyldeca-3,5,7-trien-2-imine (PubChem CID 123794526) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (3E,5Z)-4-tert-butyl-6,7-dimethyldeca-3,5,7-trien-2-imine.
| Compound Name | (3E,5Z)-4-tert-butyl-6,7-dimethyldeca-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 123794526 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (3E,5Z)-4-tert-butyl-6,7-dimethyldeca-3,5,7-trien-2-imine |
| SMILES | [H]/N=C(C)\C=C(/C=C(/C)C(C)=CCC)C(C)(C)C |
| InChI | InChI=1S/C16H27N/c1-8-9-12(2)13(3)10-15(11-14(4)17)16(5,6)7/h9-11,17H,8H2,1-7H3/b12-9?,13-10-,15-11+,17-14- |
| InChIKey | OZRFZGSJBIHVLM-SDKVQUOUSA-N |
| XLogP | 5.30 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|