C23H27Cl2FN4O2 — CID 123794672
N-[3-[[2-chloro-1-(5-chloro-3-fluoro-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 123794672) has the molecular formula C23H27Cl2FN4O2 and a molecular weight of 481.40 g/mol. Its IUPAC name is N-[3-[[2-chloro-1-(5-chloro-3-fluoro-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | N-[3-[[2-chloro-1-(5-chloro-3-fluoro-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 123794672 |
| Molecular Formula | C23H27Cl2FN4O2 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[3-[[2-chloro-1-(5-chloro-3-fluoro-2-pyridinyl)propylidene]amino]oxy-2,2-dimethylpropoxy]-2-methyl-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | Cc1ccc2c(n1)C(=NOCC(C)(C)CON=C(c1ncc(Cl)cc1F)C(C)Cl)CCC2 |
| InChI | InChI=1S/C23H27Cl2FN4O2/c1-14-8-9-16-6-5-7-19(21(16)28-14)29-31-12-23(3,4)13-32-30-20(15(2)24)22-18(26)10-17(25)11-27-22/h8-11,15H,5-7,12-13H2,1-4H3 |
| InChIKey | YHIXXBNDVRFKKP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|