C9H13N3O2 — CID 123794786
6-[(4-methylpyrazol-1-yl)methyl]-1,3-oxazinan-2-one (PubChem CID 123794786) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 6-[(4-methylpyrazol-1-yl)methyl]-1,3-oxazinan-2-one.
| Compound Name | 6-[(4-methylpyrazol-1-yl)methyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 123794786 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 6-[(4-methylpyrazol-1-yl)methyl]-1,3-oxazinan-2-one |
| SMILES | Cc1cnn(CC2CCNC(=O)O2)c1 |
| InChI | InChI=1S/C9H13N3O2/c1-7-4-11-12(5-7)6-8-2-3-10-9(13)14-8/h4-5,8H,2-3,6H2,1H3,(H,10,13) |
| InChIKey | SGYTVKVFQGQEJQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |