C34H39ClN6O4 — CID 123794806
2-anilino-6-(3-butoxy-2-chloro-5-methoxyphenyl)-8-[3-(4-prop-2-enoylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 123794806) has the molecular formula C34H39ClN6O4 and a molecular weight of 631.18 g/mol. Its IUPAC name is 2-anilino-6-(3-butoxy-2-chloro-5-methoxyphenyl)-8-[3-(4-prop-2-enoylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-6-(3-butoxy-2-chloro-5-methoxyphenyl)-8-[3-(4-prop-2-enoylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 123794806 |
| Molecular Formula | C34H39ClN6O4 |
| Molecular Weight | 631.18 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | 2-anilino-6-(3-butoxy-2-chloro-5-methoxyphenyl)-8-[3-(4-prop-2-enoylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CCN(CCCn2c(=O)c(-c3cc(OC)cc(OCCCC)c3Cl)cc3cnc(Nc4ccccc4)nc32)CC1 |
| InChI | InChI=1S/C34H39ClN6O4/c1-4-6-19-45-29-22-26(44-3)21-27(31(29)35)28-20-24-23-36-34(37-25-11-8-7-9-12-25)38-32(24)41(33(28)43)14-10-13-39-15-17-40(18-16-39)30(42)5-2/h5,7-9,11-12,20-23H,2,4,6,10,13-19H2,1,3H3,(H,36,37,38) |
| InChIKey | RGBRMEVRPXQRJC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.18 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|