C22H28O4 — CID 123794928
(1R,2S,6R,7S)-4-(2,6-diethyl-4-methylphenyl)-1-(methoxymethyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123794928) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(2,6-diethyl-4-methylphenyl)-1-(methoxymethyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-(2,6-diethyl-4-methylphenyl)-1-(methoxymethyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123794928 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (1R,2S,6R,7S)-4-(2,6-diethyl-4-methylphenyl)-1-(methoxymethyl)-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@H]2[C@@H]3CC[C@@](COC)(O3)[C@H]2C1=O |
| InChI | InChI=1S/C22H28O4/c1-5-13-9-12(3)10-14(6-2)16(13)18-20(23)17-15-7-8-22(26-15,11-25-4)19(17)21(18)24/h9-10,15,17-19H,5-8,11H2,1-4H3/t15-,17-,18?,19+,22-/m0/s1 |
| InChIKey | MMENOJOVRDIAQJ-OHTGRWAXSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|