About 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one
5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one (PubChem CID 123795324) has the molecular formula C7H14NO2S+
and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one |
| PubChem CID | 123795324 |
| Molecular Formula | C7H14NO2S+ |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one |
| SMILES | CSC1CC(O)[N+](C)(C)C1=O |
| InChI | InChI=1S/C7H14NO2S/c1-8(2)6(9)4-5(11-3)7(8)10/h5-6,9H,4H2,1-3H3/q+1 |
| InChIKey | VWXQVYKSHPROET-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one?
The IUPAC name of 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one (CID 123795324) is 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one.
What is the SMILES notation for 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one?
The canonical SMILES for 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one is CSC1CC(O)[N+](C)(C)C1=O.
What is the InChIKey of 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one?
The InChIKey is VWXQVYKSHPROET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14NO2S/c1-8(2)6(9)4-5(11-3)7(8)10/h5-6,9H,4H2,1-3H3/q+1.
What are the key properties of 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one?
5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one has a molecular weight of 176.26 g/mol, XLogP of 0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1,1-dimethyl-3-methylsulfanylpyrrolidin-1-ium-2-one is sourced from PubChem (CID 123795324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).