About 4-bromo-2,3-dihydropyridin-2-amine
4-bromo-2,3-dihydropyridin-2-amine (PubChem CID 123795666) has the molecular formula C5H7BrN2
and a molecular weight of 175.03 g/mol. Its IUPAC name is 4-bromo-2,3-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 4-bromo-2,3-dihydropyridin-2-amine |
| PubChem CID | 123795666 |
| Molecular Formula | C5H7BrN2 |
| Molecular Weight | 175.03 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 4-bromo-2,3-dihydropyridin-2-amine |
| SMILES | NC1CC(Br)=CC=N1 |
| InChI | InChI=1S/C5H7BrN2/c6-4-1-2-8-5(7)3-4/h1-2,5H,3,7H2 |
| InChIKey | KYAGGDBWGMCKPM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.03 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2,3-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3-dihydropyridin-2-amine?
The IUPAC name of 4-bromo-2,3-dihydropyridin-2-amine (CID 123795666) is 4-bromo-2,3-dihydropyridin-2-amine.
What is the SMILES notation for 4-bromo-2,3-dihydropyridin-2-amine?
The canonical SMILES for 4-bromo-2,3-dihydropyridin-2-amine is NC1CC(Br)=CC=N1.
What is the InChIKey of 4-bromo-2,3-dihydropyridin-2-amine?
The InChIKey is KYAGGDBWGMCKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrN2/c6-4-1-2-8-5(7)3-4/h1-2,5H,3,7H2.
What are the key properties of 4-bromo-2,3-dihydropyridin-2-amine?
4-bromo-2,3-dihydropyridin-2-amine has a molecular weight of 175.03 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3-dihydropyridin-2-amine is sourced from PubChem (CID 123795666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).