C14H25NO3 — CID 123795700
3-hydroxy-2,2,4,4-tetramethyl-5-oxo-N-prop-2-enylheptanamide (PubChem CID 123795700) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-hydroxy-2,2,4,4-tetramethyl-5-oxo-N-prop-2-enylheptanamide.
| Compound Name | 3-hydroxy-2,2,4,4-tetramethyl-5-oxo-N-prop-2-enylheptanamide |
|---|---|
| PubChem CID | 123795700 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 3-hydroxy-2,2,4,4-tetramethyl-5-oxo-N-prop-2-enylheptanamide |
| SMILES | C=CCNC(=O)C(C)(C)C(O)C(C)(C)C(=O)CC |
| InChI | InChI=1S/C14H25NO3/c1-7-9-15-12(18)14(5,6)11(17)13(3,4)10(16)8-2/h7,11,17H,1,8-9H2,2-6H3,(H,15,18) |
| InChIKey | QVNBAUTUCVLUQY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|