C6H15FNO+ — CID 123795704
[1,1-dideuterio-2-(fluoromethoxy)ethyl]-trimethylazanium (PubChem CID 123795704) has the molecular formula C6H15FNO+ and a molecular weight of 138.20 g/mol. Its IUPAC name is [1,1-dideuterio-2-(fluoromethoxy)ethyl]-trimethylazanium.
| Compound Name | [1,1-dideuterio-2-(fluoromethoxy)ethyl]-trimethylazanium |
|---|---|
| PubChem CID | 123795704 |
| Molecular Formula | C6H15FNO+ |
| Molecular Weight | 138.20 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | [1,1-dideuterio-2-(fluoromethoxy)ethyl]-trimethylazanium |
| SMILES | [2H]C([2H])(COCF)[N+](C)(C)C |
| InChI | InChI=1S/C6H15FNO/c1-8(2,3)4-5-9-6-7/h4-6H2,1-3H3/q+1/i4D2 |
| InChIKey | TYUACEBEGBGGMO-APZFVMQVSA-N |
| XLogP | 0.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|