About N'-but-2-en-2-yl-N-methylidenemethanimidamide
N'-but-2-en-2-yl-N-methylidenemethanimidamide (PubChem CID 123795790) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is N'-but-2-en-2-yl-N-methylidenemethanimidamide.
Molecular Properties
| Compound Name | N'-but-2-en-2-yl-N-methylidenemethanimidamide |
| PubChem CID | 123795790 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | N'-but-2-en-2-yl-N-methylidenemethanimidamide |
| SMILES | C=N/C=N/C(C)=CC |
| InChI | InChI=1S/C6H10N2/c1-4-6(2)8-5-7-3/h4-5H,3H2,1-2H3/b6-4?,8-5+ |
| InChIKey | UQXKWRKHUZLPTQ-ZDAFHCPXSA-N |
| XLogP | 1.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-but-2-en-2-yl-N-methylidenemethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-but-2-en-2-yl-N-methylidenemethanimidamide?
The IUPAC name of N'-but-2-en-2-yl-N-methylidenemethanimidamide (CID 123795790) is N'-but-2-en-2-yl-N-methylidenemethanimidamide.
What is the SMILES notation for N'-but-2-en-2-yl-N-methylidenemethanimidamide?
The canonical SMILES for N'-but-2-en-2-yl-N-methylidenemethanimidamide is C=N/C=N/C(C)=CC.
What is the InChIKey of N'-but-2-en-2-yl-N-methylidenemethanimidamide?
The InChIKey is UQXKWRKHUZLPTQ-ZDAFHCPXSA-N. The full InChI is InChI=1S/C6H10N2/c1-4-6(2)8-5-7-3/h4-5H,3H2,1-2H3/b6-4?,8-5+.
What are the key properties of N'-but-2-en-2-yl-N-methylidenemethanimidamide?
N'-but-2-en-2-yl-N-methylidenemethanimidamide has a molecular weight of 110.16 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-but-2-en-2-yl-N-methylidenemethanimidamide is sourced from PubChem (CID 123795790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).