About tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate
tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate (PubChem CID 123796283) has the molecular formula C16H25F2NO3
and a molecular weight of 317.38 g/mol. Its IUPAC name is tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate |
| PubChem CID | 123796283 |
| Molecular Formula | C16H25F2NO3 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate |
| SMILES | CC(C)C(=O)C(CC1CCC(F)(F)C1)=NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25F2NO3/c1-10(2)13(20)12(19-14(21)22-15(3,4)5)8-11-6-7-16(17,18)9-11/h10-11H,6-9H2,1-5H3 |
| InChIKey | KPTQAZDXKOVZNK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate?
The IUPAC name of tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate (CID 123796283) is tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate.
What is the SMILES notation for tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate?
The canonical SMILES for tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate is CC(C)C(=O)C(CC1CCC(F)(F)C1)=NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate?
The InChIKey is KPTQAZDXKOVZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F2NO3/c1-10(2)13(20)12(19-14(21)22-15(3,4)5)8-11-6-7-16(17,18)9-11/h10-11H,6-9H2,1-5H3.
What are the key properties of tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate?
tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate has a molecular weight of 317.38 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(3,3-difluorocyclopentyl)-4-methyl-3-oxopentan-2-ylidene]carbamate is sourced from PubChem (CID 123796283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).