C17H35NO — CID 123796456
2-amino-4-ethyl-1,4,6,6-tetramethyl-3-propylcyclooctan-1-ol (PubChem CID 123796456) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is 2-amino-4-ethyl-1,4,6,6-tetramethyl-3-propylcyclooctan-1-ol.
| Compound Name | 2-amino-4-ethyl-1,4,6,6-tetramethyl-3-propylcyclooctan-1-ol |
|---|---|
| PubChem CID | 123796456 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 2-amino-4-ethyl-1,4,6,6-tetramethyl-3-propylcyclooctan-1-ol |
| SMILES | CCCC1C(N)C(C)(O)CCC(C)(C)CC1(C)CC |
| InChI | InChI=1S/C17H35NO/c1-7-9-13-14(18)17(6,19)11-10-15(3,4)12-16(13,5)8-2/h13-14,19H,7-12,18H2,1-6H3 |
| InChIKey | YSEDOOJPKKZPBK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |