C9H11F8O5S- — CID 123796499
1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropoxy)butoxy]ethanesulfonate (PubChem CID 123796499) has the molecular formula C9H11F8O5S- and a molecular weight of 383.23 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropoxy)butoxy]ethanesulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropoxy)butoxy]ethanesulfonate |
|---|---|
| PubChem CID | 123796499 |
| Molecular Formula | C9H11F8O5S- |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoropropoxy)butoxy]ethanesulfonate |
| SMILES | CC(F)(F)C(F)(F)OCCCCOC(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H12F8O5S/c1-6(10,11)7(12,13)21-4-2-3-5-22-8(14,15)9(16,17)23(18,19)20/h2-5H2,1H3,(H,18,19,20)/p-1 |
| InChIKey | LAXQHFGFMVKKDC-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|