C33H52O4 — CID 123797002
10-(3,17-dimethylicosa-2,5,8,11,13,14-hexaenoyloxy)-3-methyldecanoic acid (PubChem CID 123797002) has the molecular formula C33H52O4 and a molecular weight of 512.78 g/mol. Its IUPAC name is 10-(3,17-dimethylicosa-2,5,8,11,13,14-hexaenoyloxy)-3-methyldecanoic acid.
| Compound Name | 10-(3,17-dimethylicosa-2,5,8,11,13,14-hexaenoyloxy)-3-methyldecanoic acid |
|---|---|
| PubChem CID | 123797002 |
| Molecular Formula | C33H52O4 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | 10-(3,17-dimethylicosa-2,5,8,11,13,14-hexaenoyloxy)-3-methyldecanoic acid |
| SMILES | CCCC(C)CC=C=CC=CCC=CCC=CCC(C)=CC(=O)OCCCCCCCC(C)CC(=O)O |
| InChI | InChI=1S/C33H52O4/c1-5-22-29(2)23-18-14-11-9-7-6-8-10-12-15-20-25-31(4)28-33(36)37-26-21-17-13-16-19-24-30(3)27-32(34)35/h7-11,15,18,20,28-30H,5-6,12-13,16-17,19,21-27H2,1-4H3,(H,34,35) |
| InChIKey | IBZJCSBFLIMVFS-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|