C21H32F3N5O — CID 123797183
6-N-cyclopentyl-3-ethyl-8-N-[(2-methylpropan-2-yl)oxymethyl]-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 123797183) has the molecular formula C21H32F3N5O and a molecular weight of 427.52 g/mol. Its IUPAC name is 6-N-cyclopentyl-3-ethyl-8-N-[(2-methylpropan-2-yl)oxymethyl]-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 6-N-cyclopentyl-3-ethyl-8-N-[(2-methylpropan-2-yl)oxymethyl]-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 123797183 |
| Molecular Formula | C21H32F3N5O |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 6-N-cyclopentyl-3-ethyl-8-N-[(2-methylpropan-2-yl)oxymethyl]-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | CCc1cnc2c(N(CCC(F)(F)F)COC(C)(C)C)cc(NC3CCCC3)nn12 |
| InChI | InChI=1S/C21H32F3N5O/c1-5-16-13-25-19-17(12-18(27-29(16)19)26-15-8-6-7-9-15)28(11-10-21(22,23)24)14-30-20(2,3)4/h12-13,15H,5-11,14H2,1-4H3,(H,26,27) |
| InChIKey | NUEQJXXGRIPODA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|