C34H27F4N5O2S — CID 123797812
3-(6-amino-3-pyridinyl)-N-[[7-(2,4-difluorophenyl)-5-[5-(4,4-difluoropiperidine-1-carbothioyl)-2-pyridinyl]-1-benzofuran-2-yl]methyl]prop-2-enamide (PubChem CID 123797812) has the molecular formula C34H27F4N5O2S and a molecular weight of 645.68 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-N-[[7-(2,4-difluorophenyl)-5-[5-(4,4-difluoropiperidine-1-carbothioyl)-2-pyridinyl]-1-benzofuran-2-yl]methyl]prop-2-enamide.
| Compound Name | 3-(6-amino-3-pyridinyl)-N-[[7-(2,4-difluorophenyl)-5-[5-(4,4-difluoropiperidine-1-carbothioyl)-2-pyridinyl]-1-benzofuran-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123797812 |
| Molecular Formula | C34H27F4N5O2S |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.18 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-N-[[7-(2,4-difluorophenyl)-5-[5-(4,4-difluoropiperidine-1-carbothioyl)-2-pyridinyl]-1-benzofuran-2-yl]methyl]prop-2-enamide |
| SMILES | Nc1ccc(C=CC(=O)NCc2cc3cc(-c4ccc(C(=S)N5CCC(F)(F)CC5)cn4)cc(-c4ccc(F)cc4F)c3o2)cn1 |
| InChI | InChI=1S/C34H27F4N5O2S/c35-24-4-5-26(28(36)16-24)27-15-22(29-6-3-21(18-40-29)33(46)43-11-9-34(37,38)10-12-43)13-23-14-25(45-32(23)27)19-42-31(44)8-2-20-1-7-30(39)41-17-20/h1-8,13-18H,9-12,19H2,(H2,39,41)(H,42,44) |
| InChIKey | FNPRQVKRRYUNEC-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|