C8H14N4O — CID 123797848
2-(2,4-diiminopentan-3-ylideneamino)propanamide (PubChem CID 123797848) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-(2,4-diiminopentan-3-ylideneamino)propanamide.
| Compound Name | 2-(2,4-diiminopentan-3-ylideneamino)propanamide |
|---|---|
| PubChem CID | 123797848 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-(2,4-diiminopentan-3-ylideneamino)propanamide |
| SMILES | [H]/N=C(\C)C(=NC(C)C(N)=O)/C(C)=N/[H] |
| InChI | InChI=1S/C8H14N4O/c1-4(9)7(5(2)10)12-6(3)8(11)13/h6,9-10H,1-3H3,(H2,11,13)/b9-4+,10-5+ |
| InChIKey | QJCPUOODMBPJDC-LUZURFALSA-N |
| XLogP | 0.38 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|