C20H32BNO4 — CID 123797854
tert-butyl N-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate (PubChem CID 123797854) has the molecular formula C20H32BNO4 and a molecular weight of 361.29 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 123797854 |
| Molecular Formula | C20H32BNO4 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | tert-butyl N-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H32BNO4/c1-18(2,3)24-17(23)22-14-8-9-15-10-12-16(13-11-15)21-25-19(4,5)20(6,7)26-21/h10-13H,8-9,14H2,1-7H3,(H,22,23) |
| InChIKey | PROGISUUFQXTTB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|