C22H13Cl3N2O4S — CID 123798059
4-(4-chloro-2-nitrophenyl)sulfanyl-1-(3-chlorophenyl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione (PubChem CID 123798059) has the molecular formula C22H13Cl3N2O4S and a molecular weight of 507.78 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenyl)sulfanyl-1-(3-chlorophenyl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-(4-chloro-2-nitrophenyl)sulfanyl-1-(3-chlorophenyl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123798059 |
| Molecular Formula | C22H13Cl3N2O4S |
| Molecular Weight | 507.78 g/mol |
| Exact Mass | 505.97 |
| IUPAC Name | 4-(4-chloro-2-nitrophenyl)sulfanyl-1-(3-chlorophenyl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)C1Sc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H13Cl3N2O4S/c23-13-6-4-12(5-7-13)19-21(32-18-9-8-15(25)11-17(18)27(30)31)20(28)22(29)26(19)16-3-1-2-14(24)10-16/h1-11,19,21H |
| InChIKey | KSPYWTWJQPWUJV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.78 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|