C29H42N6O4 — CID 123798085
2-[5-[(2R)-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidin-2-yl]pentyl]-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidine (PubChem CID 123798085) has the molecular formula C29H42N6O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is 2-[5-[(2R)-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidin-2-yl]pentyl]-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidine.
| Compound Name | 2-[5-[(2R)-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidin-2-yl]pentyl]-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidine |
|---|---|
| PubChem CID | 123798085 |
| Molecular Formula | C29H42N6O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | 2-[5-[(2R)-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidin-2-yl]pentyl]-4,4-dimethyl-1-(3-methyl-4-nitrophenyl)imidazolidine |
| SMILES | Cc1cc(N2CC(C)(C)NC2CCCCC[C@@H]2NC(C)(C)CN2c2ccc([N+](=O)[O-])c(C)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H42N6O4/c1-20-16-22(12-14-24(20)34(36)37)32-18-28(3,4)30-26(32)10-8-7-9-11-27-31-29(5,6)19-33(27)23-13-15-25(35(38)39)21(2)17-23/h12-17,26-27,30-31H,7-11,18-19H2,1-6H3/t26-,27?/m1/s1 |
| InChIKey | NJJPKHPKBBRZCC-AVJYQCBHSA-N |
| XLogP | 5.80 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|