C34H53F3N2O — CID 123798096
1-[3-(3,6,7a-trimethyl-1,3a,4,5,6,7-hexahydroisoindol-1-yl)-4-methylcyclohexyl]-2-[3-(piperidin-3-ylidenemethyl)-5-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol (PubChem CID 123798096) has the molecular formula C34H53F3N2O and a molecular weight of 562.81 g/mol. Its IUPAC name is 1-[3-(3,6,7a-trimethyl-1,3a,4,5,6,7-hexahydroisoindol-1-yl)-4-methylcyclohexyl]-2-[3-(piperidin-3-ylidenemethyl)-5-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol.
| Compound Name | 1-[3-(3,6,7a-trimethyl-1,3a,4,5,6,7-hexahydroisoindol-1-yl)-4-methylcyclohexyl]-2-[3-(piperidin-3-ylidenemethyl)-5-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123798096 |
| Molecular Formula | C34H53F3N2O |
| Molecular Weight | 562.81 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | 1-[3-(3,6,7a-trimethyl-1,3a,4,5,6,7-hexahydroisoindol-1-yl)-4-methylcyclohexyl]-2-[3-(piperidin-3-ylidenemethyl)-5-(trifluoromethyl)cyclohexyl]prop-2-en-1-ol |
| SMILES | C=C(C1CC(C=C2CCCNC2)CC(C(F)(F)F)C1)C(O)C1CCC(C)C(C2N=C(C)C3CCC(C)CC32C)C1 |
| InChI | InChI=1S/C34H53F3N2O/c1-20-8-11-30-23(4)39-32(33(30,5)18-20)29-17-26(10-9-21(29)2)31(40)22(3)27-14-25(13-24-7-6-12-38-19-24)15-28(16-27)34(35,36)37/h13,20-21,25-32,38,40H,3,6-12,14-19H2,1-2,4-5H3 |
| InChIKey | WOHAFNBPFVOQRK-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.81 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|