C35H41N3O3 — CID 123798366
1-[4-[4-[(7-methoxy-3,4,5-trimethyl-4H-2-benzazepin-1-yl)methyl]-5-methyl-3,4,5,6-tetrahydro-2H-1-benzoxocin-8-yl]phenyl]-3-methylurea (PubChem CID 123798366) has the molecular formula C35H41N3O3 and a molecular weight of 551.73 g/mol. Its IUPAC name is 1-[4-[4-[(7-methoxy-3,4,5-trimethyl-4H-2-benzazepin-1-yl)methyl]-5-methyl-3,4,5,6-tetrahydro-2H-1-benzoxocin-8-yl]phenyl]-3-methylurea.
| Compound Name | 1-[4-[4-[(7-methoxy-3,4,5-trimethyl-4H-2-benzazepin-1-yl)methyl]-5-methyl-3,4,5,6-tetrahydro-2H-1-benzoxocin-8-yl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 123798366 |
| Molecular Formula | C35H41N3O3 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 1-[4-[4-[(7-methoxy-3,4,5-trimethyl-4H-2-benzazepin-1-yl)methyl]-5-methyl-3,4,5,6-tetrahydro-2H-1-benzoxocin-8-yl]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(-c2ccc3c(c2)CC(C)C(CC2=c4ccc(OC)cc4=C(C)C(C)C(C)=N2)CCO3)cc1 |
| InChI | InChI=1S/C35H41N3O3/c1-21-17-28-18-27(25-7-10-29(11-8-25)38-35(39)36-5)9-14-34(28)41-16-15-26(21)19-33-31-13-12-30(40-6)20-32(31)23(3)22(2)24(4)37-33/h7-14,18,20-22,26H,15-17,19H2,1-6H3,(H2,36,38,39) |
| InChIKey | SLDQEXJOCGJLJT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |