About 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane
7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 123798369) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 123798369 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CCC1C2CN(C)C1CN2C |
| InChI | InChI=1S/C9H18N2/c1-4-7-8-6-11(3)9(7)5-10(8)2/h7-9H,4-6H2,1-3H3 |
| InChIKey | BPUSCJICOJJGPX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane (CID 123798369) is 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane is CCC1C2CN(C)C1CN2C.
What is the InChIKey of 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is BPUSCJICOJJGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-4-7-8-6-11(3)9(7)5-10(8)2/h7-9H,4-6H2,1-3H3.
What are the key properties of 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane?
7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 154.26 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 123798369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).