C24H26FN4O3+ — CID 123799302
2-(2,2-dimethylpropyl)-7-[5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one (PubChem CID 123799302) has the molecular formula C24H26FN4O3+ and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-7-[5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one.
| Compound Name | 2-(2,2-dimethylpropyl)-7-[5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 123799302 |
| Molecular Formula | C24H26FN4O3+ |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-7-[5-(4-fluorophenyl)pyrrolo[1,2-a]imidazol-4-ium-2-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
| SMILES | CC(C)(C)CC1OC2CN(C(=O)C3=C[N+]4=C(c5ccc(F)cc5)C=CC4=N3)CCN2C1=O |
| InChI | InChI=1S/C24H26FN4O3/c1-24(2,3)12-19-23(31)28-11-10-27(14-21(28)32-19)22(30)17-13-29-18(8-9-20(29)26-17)15-4-6-16(25)7-5-15/h4-9,13,19,21H,10-12,14H2,1-3H3/q+1 |
| InChIKey | WVGXZHCGYQKTGH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|