C33H47N5O4 — CID 123799939
3-[2-(benzylamino)-1-[[1-[3-[ethyl(propyl)amino]propylamino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-6-methyl-1H-indole-2-carboxylic acid (PubChem CID 123799939) has the molecular formula C33H47N5O4 and a molecular weight of 577.77 g/mol. Its IUPAC name is 3-[2-(benzylamino)-1-[[1-[3-[ethyl(propyl)amino]propylamino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-6-methyl-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-(benzylamino)-1-[[1-[3-[ethyl(propyl)amino]propylamino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-6-methyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 123799939 |
| Molecular Formula | C33H47N5O4 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.36 |
| IUPAC Name | 3-[2-(benzylamino)-1-[[1-[3-[ethyl(propyl)amino]propylamino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]-6-methyl-1H-indole-2-carboxylic acid |
| SMILES | CCCN(CC)CCCNC(=O)C(CC(C)C)NC(C(=O)NCc1ccccc1)c1c(C(=O)O)[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C33H47N5O4/c1-6-17-38(7-2)18-11-16-34-31(39)27(19-22(3)4)37-29(32(40)35-21-24-12-9-8-10-13-24)28-25-15-14-23(5)20-26(25)36-30(28)33(41)42/h8-10,12-15,20,22,27,29,36-37H,6-7,11,16-19,21H2,1-5H3,(H,34,39)(H,35,40)(H,41,42) |
| InChIKey | CHTGVCCXRDZBLX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|