C20H24F3N5 — CID 123801240
10,12-dimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(11),3,5,7,12,14-hexaene (PubChem CID 123801240) has the molecular formula C20H24F3N5 and a molecular weight of 391.44 g/mol. Its IUPAC name is 10,12-dimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(11),3,5,7,12,14-hexaene.
| Compound Name | 10,12-dimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(11),3,5,7,12,14-hexaene |
|---|---|
| PubChem CID | 123801240 |
| Molecular Formula | C20H24F3N5 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 10,12-dimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-2,4,5-triazatricyclo[9.4.0.02,6]pentadeca-1(11),3,5,7,12,14-hexaene |
| SMILES | Cc1cc(C(F)(F)F)cc2c1C(C)CC=C(N1CCN(C)CC1)c1nncn1-2 |
| InChI | InChI=1S/C20H24F3N5/c1-13-4-5-16(27-8-6-26(3)7-9-27)19-25-24-12-28(19)17-11-15(20(21,22)23)10-14(2)18(13)17/h5,10-13H,4,6-9H2,1-3H3 |
| InChIKey | DVFVBLFTKVUPKR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |